C13H17Br2NO — CID 14820859
2,3-dibromo-N-(2,6-diethylphenyl)propanamide (PubChem CID 14820859) has the molecular formula C13H17Br2NO and a molecular weight of 363.09 g/mol. Its IUPAC name is 2,3-dibromo-N-(2,6-diethylphenyl)propanamide.
| Compound Name | 2,3-dibromo-N-(2,6-diethylphenyl)propanamide |
|---|---|
| PubChem CID | 14820859 |
| Molecular Formula | C13H17Br2NO |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 2,3-dibromo-N-(2,6-diethylphenyl)propanamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(Br)CBr |
| InChI | InChI=1S/C13H17Br2NO/c1-3-9-6-5-7-10(4-2)12(9)16-13(17)11(15)8-14/h5-7,11H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | JMCPEUTXTLORDJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|