C14H17ClF3N3O — CID 119906204
N-[2-chloro-6-(trifluoromethyl)phenyl]-2-(1,4-diazepan-1-yl)acetamide (PubChem CID 119906204) has the molecular formula C14H17ClF3N3O and a molecular weight of 335.76 g/mol. Its IUPAC name is N-[2-chloro-6-(trifluoromethyl)phenyl]-2-(1,4-diazepan-1-yl)acetamide.
| Compound Name | N-[2-chloro-6-(trifluoromethyl)phenyl]-2-(1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 119906204 |
| Molecular Formula | C14H17ClF3N3O |
| Molecular Weight | 335.76 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-[2-chloro-6-(trifluoromethyl)phenyl]-2-(1,4-diazepan-1-yl)acetamide |
| SMILES | O=C(CN1CCCNCC1)Nc1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C14H17ClF3N3O/c15-11-4-1-3-10(14(16,17)18)13(11)20-12(22)9-21-7-2-5-19-6-8-21/h1,3-4,19H,2,5-9H2,(H,20,22) |
| InChIKey | LZDKEYLEUQAPQM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.76 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |