C12H17FN4O — CID 116813264
2-(1,4-diazepan-1-yl)-N-(6-fluoro-2-pyridinyl)acetamide (PubChem CID 116813264) has the molecular formula C12H17FN4O and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(6-fluoro-2-pyridinyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(6-fluoro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 116813264 |
| Molecular Formula | C12H17FN4O |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(6-fluoro-2-pyridinyl)acetamide |
| SMILES | O=C(CN1CCCNCC1)Nc1cccc(F)n1 |
| InChI | InChI=1S/C12H17FN4O/c13-10-3-1-4-11(15-10)16-12(18)9-17-7-2-5-14-6-8-17/h1,3-4,14H,2,5-9H2,(H,15,16,18) |
| InChIKey | BFTJXUVAGAXMLC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|