C14H22Cl2N2 — CID 119908754
1-[1-(4-chlorophenyl)propyl]piperidin-4-amine;hydrochloride (PubChem CID 119908754) has the molecular formula C14H22Cl2N2 and a molecular weight of 289.25 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)propyl]piperidin-4-amine;hydrochloride.
| Compound Name | 1-[1-(4-chlorophenyl)propyl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119908754 |
| Molecular Formula | C14H22Cl2N2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 1-[1-(4-chlorophenyl)propyl]piperidin-4-amine;hydrochloride |
| SMILES | CCC(c1ccc(Cl)cc1)N1CCC(N)CC1.Cl |
| InChI | InChI=1S/C14H21ClN2.ClH/c1-2-14(11-3-5-12(15)6-4-11)17-9-7-13(16)8-10-17;/h3-6,13-14H,2,7-10,16H2,1H3;1H |
| InChIKey | RVWUVALNAMWIIY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |