C15H23Cl2N — CID 3056499
1-[1-(4-chlorophenyl)propyl]-4-methylpiperidine;hydrochloride (PubChem CID 3056499) has the molecular formula C15H23Cl2N and a molecular weight of 288.26 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)propyl]-4-methylpiperidine;hydrochloride.
| Compound Name | 1-[1-(4-chlorophenyl)propyl]-4-methylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 3056499 |
| Molecular Formula | C15H23Cl2N |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-[1-(4-chlorophenyl)propyl]-4-methylpiperidine;hydrochloride |
| SMILES | CCC(c1ccc(Cl)cc1)N1CCC(C)CC1.Cl |
| InChI | InChI=1S/C15H22ClN.ClH/c1-3-15(13-4-6-14(16)7-5-13)17-10-8-12(2)9-11-17;/h4-7,12,15H,3,8-11H2,1-2H3;1H |
| InChIKey | DTZLCHFEILLXBO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |