C20H21ClN2OS — CID 134108745
2-[4-(4-chlorophenyl)sulfinylphenyl]-2-(4-methylpiperidin-1-yl)acetonitrile (PubChem CID 134108745) has the molecular formula C20H21ClN2OS and a molecular weight of 372.92 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfinylphenyl]-2-(4-methylpiperidin-1-yl)acetonitrile.
| Compound Name | 2-[4-(4-chlorophenyl)sulfinylphenyl]-2-(4-methylpiperidin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 134108745 |
| Molecular Formula | C20H21ClN2OS |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfinylphenyl]-2-(4-methylpiperidin-1-yl)acetonitrile |
| SMILES | CC1CCN(C(C#N)c2ccc(S(=O)c3ccc(Cl)cc3)cc2)CC1 |
| InChI | InChI=1S/C20H21ClN2OS/c1-15-10-12-23(13-11-15)20(14-22)16-2-6-18(7-3-16)25(24)19-8-4-17(21)5-9-19/h2-9,15,20H,10-13H2,1H3 |
| InChIKey | RPVXVCUTXUISGQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |