C21H33N — CID 11991255
(2R)-2-heptyl-1-methyl-4-(3-phenylpropyl)-2,5-dihydropyrrole (PubChem CID 11991255) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is (2R)-2-heptyl-1-methyl-4-(3-phenylpropyl)-2,5-dihydropyrrole.
| Compound Name | (2R)-2-heptyl-1-methyl-4-(3-phenylpropyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 11991255 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | (2R)-2-heptyl-1-methyl-4-(3-phenylpropyl)-2,5-dihydropyrrole |
| SMILES | CCCCCCC[C@@H]1C=C(CCCc2ccccc2)CN1C |
| InChI | InChI=1S/C21H33N/c1-3-4-5-6-10-16-21-17-20(18-22(21)2)15-11-14-19-12-8-7-9-13-19/h7-9,12-13,17,21H,3-6,10-11,14-16,18H2,1-2H3/t21-/m1/s1 |
| InChIKey | ZJMAERRWNOYXQJ-OAQYLSRUSA-N |
| XLogP | 5.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|