C17H25N — CID 11991250
(2S)-1-methyl-4-(3-phenylpropyl)-2-propan-2-yl-2,5-dihydropyrrole (PubChem CID 11991250) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (2S)-1-methyl-4-(3-phenylpropyl)-2-propan-2-yl-2,5-dihydropyrrole.
| Compound Name | (2S)-1-methyl-4-(3-phenylpropyl)-2-propan-2-yl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 11991250 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (2S)-1-methyl-4-(3-phenylpropyl)-2-propan-2-yl-2,5-dihydropyrrole |
| SMILES | CC(C)[C@H]1C=C(CCCc2ccccc2)CN1C |
| InChI | InChI=1S/C17H25N/c1-14(2)17-12-16(13-18(17)3)11-7-10-15-8-5-4-6-9-15/h4-6,8-9,12,14,17H,7,10-11,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | JEIQTBFPDFHUFU-QGZVFWFLSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|