About 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride
2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride (PubChem CID 119912606) has the molecular formula C14H18ClN3O3
and a molecular weight of 311.77 g/mol. Its IUPAC name is 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride |
| PubChem CID | 119912606 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)Cc1nc(Cc2ccccc2)no1.Cl |
| InChI | InChI=1S/C14H17N3O3.ClH/c1-10(14(18)19)17(2)9-13-15-12(16-20-13)8-11-6-4-3-5-7-11;/h3-7,10H,8-9H2,1-2H3,(H,18,19);1H |
| InChIKey | HCIDXNIKNRTKMD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride?
The IUPAC name of 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride (CID 119912606) is 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride.
What is the SMILES notation for 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride?
The canonical SMILES for 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride is CC(C(=O)O)N(C)Cc1nc(Cc2ccccc2)no1.Cl.
What is the InChIKey of 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride?
The InChIKey is HCIDXNIKNRTKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3.ClH/c1-10(14(18)19)17(2)9-13-15-12(16-20-13)8-11-6-4-3-5-7-11;/h3-7,10H,8-9H2,1-2H3,(H,18,19);1H.
What are the key properties of 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride?
2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride has a molecular weight of 311.77 g/mol, XLogP of 1.99, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl-methylamino]propanoic acid;hydrochloride is sourced from PubChem (CID 119912606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).