C14H21ClN2O3 — CID 119913207
2-[methyl-[2-[(2-methylphenyl)methylamino]-2-oxoethyl]amino]propanoic acid;hydrochloride (PubChem CID 119913207) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is 2-[methyl-[2-[(2-methylphenyl)methylamino]-2-oxoethyl]amino]propanoic acid;hydrochloride.
| Compound Name | 2-[methyl-[2-[(2-methylphenyl)methylamino]-2-oxoethyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913207 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-[methyl-[2-[(2-methylphenyl)methylamino]-2-oxoethyl]amino]propanoic acid;hydrochloride |
| SMILES | Cc1ccccc1CNC(=O)CN(C)C(C)C(=O)O.Cl |
| InChI | InChI=1S/C14H20N2O3.ClH/c1-10-6-4-5-7-12(10)8-15-13(17)9-16(3)11(2)14(18)19;/h4-7,11H,8-9H2,1-3H3,(H,15,17)(H,18,19);1H |
| InChIKey | RLSQMSKQUFDQKB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |