C13H26ClNO3 — CID 119913474
2-[methyl-[2-(2-methylcyclohexyl)oxyethyl]amino]propanoic acid;hydrochloride (PubChem CID 119913474) has the molecular formula C13H26ClNO3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 2-[methyl-[2-(2-methylcyclohexyl)oxyethyl]amino]propanoic acid;hydrochloride.
| Compound Name | 2-[methyl-[2-(2-methylcyclohexyl)oxyethyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913474 |
| Molecular Formula | C13H26ClNO3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-[methyl-[2-(2-methylcyclohexyl)oxyethyl]amino]propanoic acid;hydrochloride |
| SMILES | CC1CCCCC1OCCN(C)C(C)C(=O)O.Cl |
| InChI | InChI=1S/C13H25NO3.ClH/c1-10-6-4-5-7-12(10)17-9-8-14(3)11(2)13(15)16;/h10-12H,4-9H2,1-3H3,(H,15,16);1H |
| InChIKey | BFTNUQBWTFVVCW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |