C17H32N2O4 — CID 122100182
(2S,3S)-3-methyl-2-[[2-[2-(2-methylcyclohexyl)oxyethylamino]-2-oxoethyl]amino]pentanoic acid (PubChem CID 122100182) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[2-[2-(2-methylcyclohexyl)oxyethylamino]-2-oxoethyl]amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[[2-[2-(2-methylcyclohexyl)oxyethylamino]-2-oxoethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122100182 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[2-[2-(2-methylcyclohexyl)oxyethylamino]-2-oxoethyl]amino]pentanoic acid |
| SMILES | CC[C@H](C)C(NCC(=O)NCCOC1CCCCC1C)C(=O)O |
| InChI | InChI=1S/C17H32N2O4/c1-4-12(2)16(17(21)22)19-11-15(20)18-9-10-23-14-8-6-5-7-13(14)3/h12-14,16,19H,4-11H2,1-3H3,(H,18,20)(H,21,22)/t12-,13?,14?,16?/m0/s1 |
| InChIKey | SPHXVWKOWUORRC-BAYAOMGESA-N |
| XLogP | 1.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|