C19H21N3O3 — CID 119913764
2-[[1-(4-methoxyphenyl)benzimidazol-2-yl]methyl-methylamino]propanoic acid (PubChem CID 119913764) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-[[1-(4-methoxyphenyl)benzimidazol-2-yl]methyl-methylamino]propanoic acid.
| Compound Name | 2-[[1-(4-methoxyphenyl)benzimidazol-2-yl]methyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119913764 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[[1-(4-methoxyphenyl)benzimidazol-2-yl]methyl-methylamino]propanoic acid |
| SMILES | COc1ccc(-n2c(CN(C)C(C)C(=O)O)nc3ccccc32)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-13(19(23)24)21(2)12-18-20-16-6-4-5-7-17(16)22(18)14-8-10-15(25-3)11-9-14/h4-11,13H,12H2,1-3H3,(H,23,24) |
| InChIKey | IFHWJYOFZVETRK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |