C18H27ClN4O2 — CID 119916680
N-(2-aminoethyl)-1-[2-[1-(2-chlorophenyl)ethylamino]-2-oxoethyl]piperidine-3-carboxamide (PubChem CID 119916680) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[2-[1-(2-chlorophenyl)ethylamino]-2-oxoethyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[2-[1-(2-chlorophenyl)ethylamino]-2-oxoethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119916680 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-(2-aminoethyl)-1-[2-[1-(2-chlorophenyl)ethylamino]-2-oxoethyl]piperidine-3-carboxamide |
| SMILES | CC(NC(=O)CN1CCCC(C(=O)NCCN)C1)c1ccccc1Cl |
| InChI | InChI=1S/C18H27ClN4O2/c1-13(15-6-2-3-7-16(15)19)22-17(24)12-23-10-4-5-14(11-23)18(25)21-9-8-20/h2-3,6-7,13-14H,4-5,8-12,20H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | BJUJYIPRIROCBO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |