C12H23ClF3N3O2 — CID 119916688
N-(2-aminoethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119916688) has the molecular formula C12H23ClF3N3O2 and a molecular weight of 333.78 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119916688 |
| Molecular Formula | C12H23ClF3N3O2 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-(2-aminoethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)C1CCCN(CCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H22F3N3O2.ClH/c13-12(14,15)9-20-7-6-18-5-1-2-10(8-18)11(19)17-4-3-16;/h10H,1-9,16H2,(H,17,19);1H |
| InChIKey | VMFMSXGNWQNKAD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|