C16H24FN3O2 — CID 119916756
N-(2-aminoethyl)-1-[2-(4-fluorophenoxy)ethyl]piperidine-3-carboxamide (PubChem CID 119916756) has the molecular formula C16H24FN3O2 and a molecular weight of 309.38 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[2-(4-fluorophenoxy)ethyl]piperidine-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[2-(4-fluorophenoxy)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119916756 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-(2-aminoethyl)-1-[2-(4-fluorophenoxy)ethyl]piperidine-3-carboxamide |
| SMILES | NCCNC(=O)C1CCCN(CCOc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H24FN3O2/c17-14-3-5-15(6-4-14)22-11-10-20-9-1-2-13(12-20)16(21)19-8-7-18/h3-6,13H,1-2,7-12,18H2,(H,19,21) |
| InChIKey | LWNZKDUKUGOSQT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |