C15H27Cl2N3 — CID 119918743
N-methyl-1-[2-(N-methylanilino)ethyl]piperidin-3-amine;dihydrochloride (PubChem CID 119918743) has the molecular formula C15H27Cl2N3 and a molecular weight of 320.31 g/mol. Its IUPAC name is N-methyl-1-[2-(N-methylanilino)ethyl]piperidin-3-amine;dihydrochloride.
| Compound Name | N-methyl-1-[2-(N-methylanilino)ethyl]piperidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 119918743 |
| Molecular Formula | C15H27Cl2N3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | N-methyl-1-[2-(N-methylanilino)ethyl]piperidin-3-amine;dihydrochloride |
| SMILES | CNC1CCCN(CCN(C)c2ccccc2)C1.Cl.Cl |
| InChI | InChI=1S/C15H25N3.2ClH/c1-16-14-7-6-10-18(13-14)12-11-17(2)15-8-4-3-5-9-15;;/h3-5,8-9,14,16H,6-7,10-13H2,1-2H3;2*1H |
| InChIKey | WKCKYNWJNQCHKN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |