C16H22BrCl2N3 — CID 119919750
1-[(6-bromoquinolin-8-yl)methyl]-N-methylpiperidin-3-amine;dihydrochloride (PubChem CID 119919750) has the molecular formula C16H22BrCl2N3 and a molecular weight of 407.18 g/mol. Its IUPAC name is 1-[(6-bromoquinolin-8-yl)methyl]-N-methylpiperidin-3-amine;dihydrochloride.
| Compound Name | 1-[(6-bromoquinolin-8-yl)methyl]-N-methylpiperidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 119919750 |
| Molecular Formula | C16H22BrCl2N3 |
| Molecular Weight | 407.18 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 1-[(6-bromoquinolin-8-yl)methyl]-N-methylpiperidin-3-amine;dihydrochloride |
| SMILES | CNC1CCCN(Cc2cc(Br)cc3cccnc23)C1.Cl.Cl |
| InChI | InChI=1S/C16H20BrN3.2ClH/c1-18-15-5-3-7-20(11-15)10-13-9-14(17)8-12-4-2-6-19-16(12)13;;/h2,4,6,8-9,15,18H,3,5,7,10-11H2,1H3;2*1H |
| InChIKey | KFGMUPDWSJPDBJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |