C14H25Cl2N3 — CID 119920848
1-[1-(2-pyridin-3-ylethyl)piperidin-4-yl]ethanamine;dihydrochloride (PubChem CID 119920848) has the molecular formula C14H25Cl2N3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-[1-(2-pyridin-3-ylethyl)piperidin-4-yl]ethanamine;dihydrochloride.
| Compound Name | 1-[1-(2-pyridin-3-ylethyl)piperidin-4-yl]ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 119920848 |
| Molecular Formula | C14H25Cl2N3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-[1-(2-pyridin-3-ylethyl)piperidin-4-yl]ethanamine;dihydrochloride |
| SMILES | CC(N)C1CCN(CCc2cccnc2)CC1.Cl.Cl |
| InChI | InChI=1S/C14H23N3.2ClH/c1-12(15)14-5-9-17(10-6-14)8-4-13-3-2-7-16-11-13;;/h2-3,7,11-12,14H,4-6,8-10,15H2,1H3;2*1H |
| InChIKey | YWXNYAHUONKHPC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |