C13H20N2 — CID 95821334
3-[(1-ethylpiperidin-4-yl)methyl]pyridine (PubChem CID 95821334) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-[(1-ethylpiperidin-4-yl)methyl]pyridine.
| Compound Name | 3-[(1-ethylpiperidin-4-yl)methyl]pyridine |
|---|---|
| PubChem CID | 95821334 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-[(1-ethylpiperidin-4-yl)methyl]pyridine |
| SMILES | CCN1CCC(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C13H20N2/c1-2-15-8-5-12(6-9-15)10-13-4-3-7-14-11-13/h3-4,7,11-12H,2,5-6,8-10H2,1H3 |
| InChIKey | HDJVRBKQKQFZRQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |