C12H16N2 — CID 175739171
3-[(1-ethenylpyrrolidin-3-yl)methyl]pyridine (PubChem CID 175739171) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-[(1-ethenylpyrrolidin-3-yl)methyl]pyridine.
| Compound Name | 3-[(1-ethenylpyrrolidin-3-yl)methyl]pyridine |
|---|---|
| PubChem CID | 175739171 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-[(1-ethenylpyrrolidin-3-yl)methyl]pyridine |
| SMILES | C=CN1CCC(Cc2cccnc2)C1 |
| InChI | InChI=1S/C12H16N2/c1-2-14-7-5-12(10-14)8-11-4-3-6-13-9-11/h2-4,6,9,12H,1,5,7-8,10H2 |
| InChIKey | LIFIZGMAGRCAGI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |