C16H23ClN4O2 — CID 119921165
5,5-dimethyl-3-[2-(2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)ethyl]imidazolidine-2,4-dione;hydrochloride (PubChem CID 119921165) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-(2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)ethyl]imidazolidine-2,4-dione;hydrochloride.
| Compound Name | 5,5-dimethyl-3-[2-(2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)ethyl]imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 119921165 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 5,5-dimethyl-3-[2-(2,3,4,5-tetrahydro-1,4-benzodiazepin-1-yl)ethyl]imidazolidine-2,4-dione;hydrochloride |
| SMILES | CC1(C)NC(=O)N(CCN2CCNCc3ccccc32)C1=O.Cl |
| InChI | InChI=1S/C16H22N4O2.ClH/c1-16(2)14(21)20(15(22)18-16)10-9-19-8-7-17-11-12-5-3-4-6-13(12)19;/h3-6,17H,7-11H2,1-2H3,(H,18,22);1H |
| InChIKey | BPGXPRUSUVPWTA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|