C14H23ClN2 — CID 119929267
N-ethyl-N-(piperidin-3-ylmethyl)aniline;hydrochloride (PubChem CID 119929267) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is N-ethyl-N-(piperidin-3-ylmethyl)aniline;hydrochloride.
| Compound Name | N-ethyl-N-(piperidin-3-ylmethyl)aniline;hydrochloride |
|---|---|
| PubChem CID | 119929267 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-ethyl-N-(piperidin-3-ylmethyl)aniline;hydrochloride |
| SMILES | CCN(CC1CCCNC1)c1ccccc1.Cl |
| InChI | InChI=1S/C14H22N2.ClH/c1-2-16(14-8-4-3-5-9-14)12-13-7-6-10-15-11-13;/h3-5,8-9,13,15H,2,6-7,10-12H2,1H3;1H |
| InChIKey | BMUSDBSGJXAAJI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |