About N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride
N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride (PubChem CID 119929750) has the molecular formula C14H20ClFN4O
and a molecular weight of 314.79 g/mol. Its IUPAC name is N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride.
Molecular Properties
| Compound Name | N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride |
| PubChem CID | 119929750 |
| Molecular Formula | C14H20ClFN4O |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride |
| SMILES | CCN(Cc1nc(C(C)(C)N)no1)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C14H19FN4O.ClH/c1-4-19(11-7-5-10(15)6-8-11)9-12-17-13(18-20-12)14(2,3)16;/h5-8H,4,9,16H2,1-3H3;1H |
| InChIKey | ZYPGVBCYUCQCMO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride?
The IUPAC name of N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride (CID 119929750) is N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride.
What is the SMILES notation for N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride?
The canonical SMILES for N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride is CCN(Cc1nc(C(C)(C)N)no1)c1ccc(F)cc1.Cl.
What is the InChIKey of N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride?
The InChIKey is ZYPGVBCYUCQCMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN4O.ClH/c1-4-19(11-7-5-10(15)6-8-11)9-12-17-13(18-20-12)14(2,3)16;/h5-8H,4,9,16H2,1-3H3;1H.
What are the key properties of N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride?
N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride has a molecular weight of 314.79 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(2-aminopropan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]-N-ethyl-4-fluoroaniline;hydrochloride is sourced from PubChem (CID 119929750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).