C19H29N3O2 — CID 119931825
N-(2-methoxy-5-methylphenyl)-1-(piperidin-4-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 119931825) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-1-(piperidin-4-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-1-(piperidin-4-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 119931825 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-1-(piperidin-4-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)C1CCCN1CC1CCNCC1 |
| InChI | InChI=1S/C19H29N3O2/c1-14-5-6-18(24-2)16(12-14)21-19(23)17-4-3-11-22(17)13-15-7-9-20-10-8-15/h5-6,12,15,17,20H,3-4,7-11,13H2,1-2H3,(H,21,23) |
| InChIKey | GRBXWGCUGKIPHH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |