C15H24ClF3N4 — CID 119932299
1-(piperidin-3-ylmethyl)-3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]piperidine;hydrochloride (PubChem CID 119932299) has the molecular formula C15H24ClF3N4 and a molecular weight of 352.83 g/mol. Its IUPAC name is 1-(piperidin-3-ylmethyl)-3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]piperidine;hydrochloride.
| Compound Name | 1-(piperidin-3-ylmethyl)-3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 119932299 |
| Molecular Formula | C15H24ClF3N4 |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-(piperidin-3-ylmethyl)-3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]piperidine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cc(C2CCCN(CC3CCCNC3)C2)[nH]n1 |
| InChI | InChI=1S/C15H23F3N4.ClH/c16-15(17,18)14-7-13(20-21-14)12-4-2-6-22(10-12)9-11-3-1-5-19-8-11;/h7,11-12,19H,1-6,8-10H2,(H,20,21);1H |
| InChIKey | KBPHJGVZSJQTFU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |