C15H16F3N3O2 — CID 167974307
2-(furan-3-yl)-1-[3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]piperidin-1-yl]ethanone (PubChem CID 167974307) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 2-(furan-3-yl)-1-[3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 2-(furan-3-yl)-1-[3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 167974307 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(furan-3-yl)-1-[3-[3-(trifluoromethyl)-1H-pyrazol-5-yl]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccoc1)N1CCCC(c2cc(C(F)(F)F)n[nH]2)C1 |
| InChI | InChI=1S/C15H16F3N3O2/c16-15(17,18)13-7-12(19-20-13)11-2-1-4-21(8-11)14(22)6-10-3-5-23-9-10/h3,5,7,9,11H,1-2,4,6,8H2,(H,19,20) |
| InChIKey | LQSHBRLKLNIRAJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |