C10H21ClN6 — CID 119932438
N-methyl-N-[(1-methyltetrazol-5-yl)methyl]-1-piperidin-4-ylmethanamine;hydrochloride (PubChem CID 119932438) has the molecular formula C10H21ClN6 and a molecular weight of 260.77 g/mol. Its IUPAC name is N-methyl-N-[(1-methyltetrazol-5-yl)methyl]-1-piperidin-4-ylmethanamine;hydrochloride.
| Compound Name | N-methyl-N-[(1-methyltetrazol-5-yl)methyl]-1-piperidin-4-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 119932438 |
| Molecular Formula | C10H21ClN6 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-methyl-N-[(1-methyltetrazol-5-yl)methyl]-1-piperidin-4-ylmethanamine;hydrochloride |
| SMILES | CN(Cc1nnnn1C)CC1CCNCC1.Cl |
| InChI | InChI=1S/C10H20N6.ClH/c1-15(7-9-3-5-11-6-4-9)8-10-12-13-14-16(10)2;/h9,11H,3-8H2,1-2H3;1H |
| InChIKey | PBIDOWBRLGKMPT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |