C19H30ClFN2 — CID 119932442
N-[2-(4-fluorophenyl)ethyl]-N-(piperidin-3-ylmethyl)cyclopentanamine;hydrochloride (PubChem CID 119932442) has the molecular formula C19H30ClFN2 and a molecular weight of 340.91 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-N-(piperidin-3-ylmethyl)cyclopentanamine;hydrochloride.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-N-(piperidin-3-ylmethyl)cyclopentanamine;hydrochloride |
|---|---|
| PubChem CID | 119932442 |
| Molecular Formula | C19H30ClFN2 |
| Molecular Weight | 340.91 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-N-(piperidin-3-ylmethyl)cyclopentanamine;hydrochloride |
| SMILES | Cl.Fc1ccc(CCN(CC2CCCNC2)C2CCCC2)cc1 |
| InChI | InChI=1S/C19H29FN2.ClH/c20-18-9-7-16(8-10-18)11-13-22(19-5-1-2-6-19)15-17-4-3-12-21-14-17;/h7-10,17,19,21H,1-6,11-15H2;1H |
| InChIKey | ADRSNWOQRCGWKT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |