C19H25FN4 — CID 119932633
4-[[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]pyrrolidin-1-yl]methyl]piperidine (PubChem CID 119932633) has the molecular formula C19H25FN4 and a molecular weight of 328.43 g/mol. Its IUPAC name is 4-[[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]pyrrolidin-1-yl]methyl]piperidine.
| Compound Name | 4-[[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]pyrrolidin-1-yl]methyl]piperidine |
|---|---|
| PubChem CID | 119932633 |
| Molecular Formula | C19H25FN4 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 4-[[2-[5-(4-fluorophenyl)-1H-imidazol-2-yl]pyrrolidin-1-yl]methyl]piperidine |
| SMILES | Fc1ccc(-c2cnc(C3CCCN3CC3CCNCC3)[nH]2)cc1 |
| InChI | InChI=1S/C19H25FN4/c20-16-5-3-15(4-6-16)17-12-22-19(23-17)18-2-1-11-24(18)13-14-7-9-21-10-8-14/h3-6,12,14,18,21H,1-2,7-11,13H2,(H,22,23) |
| InChIKey | FWZVKBDVGHCMBN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |