C17H24N4S — CID 174162673
4-[2-[1-(2-methylsulfanylpropyl)piperidin-2-yl]-1H-imidazol-5-yl]pyridine (PubChem CID 174162673) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is 4-[2-[1-(2-methylsulfanylpropyl)piperidin-2-yl]-1H-imidazol-5-yl]pyridine.
| Compound Name | 4-[2-[1-(2-methylsulfanylpropyl)piperidin-2-yl]-1H-imidazol-5-yl]pyridine |
|---|---|
| PubChem CID | 174162673 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-[2-[1-(2-methylsulfanylpropyl)piperidin-2-yl]-1H-imidazol-5-yl]pyridine |
| SMILES | CSC(C)CN1CCCCC1c1ncc(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C17H24N4S/c1-13(22-2)12-21-10-4-3-5-16(21)17-19-11-15(20-17)14-6-8-18-9-7-14/h6-9,11,13,16H,3-5,10,12H2,1-2H3,(H,19,20) |
| InChIKey | OMKLJJBXGLTKAR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |