C17H26ClN3O3 — CID 119933342
1-[(4-methoxy-3-nitrophenyl)methyl]-1,4-diazaspiro[5.5]undecane;hydrochloride (PubChem CID 119933342) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-[(4-methoxy-3-nitrophenyl)methyl]-1,4-diazaspiro[5.5]undecane;hydrochloride.
| Compound Name | 1-[(4-methoxy-3-nitrophenyl)methyl]-1,4-diazaspiro[5.5]undecane;hydrochloride |
|---|---|
| PubChem CID | 119933342 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[(4-methoxy-3-nitrophenyl)methyl]-1,4-diazaspiro[5.5]undecane;hydrochloride |
| SMILES | COc1ccc(CN2CCNCC23CCCCC3)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C17H25N3O3.ClH/c1-23-16-6-5-14(11-15(16)20(21)22)12-19-10-9-18-13-17(19)7-3-2-4-8-17;/h5-6,11,18H,2-4,7-10,12-13H2,1H3;1H |
| InChIKey | WONZTFIEHUPLHE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|