C31H36N4O2 — CID 11993406
(3R,4S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-4-quinolin-6-ylpiperidine-3-carboxamide (PubChem CID 11993406) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is (3R,4S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-4-quinolin-6-ylpiperidine-3-carboxamide.
| Compound Name | (3R,4S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-4-quinolin-6-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 11993406 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (3R,4S)-N-cyclopropyl-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]-4-quinolin-6-ylpiperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CNCC[C@@H]2c2ccc3ncccc3c2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C31H36N4O2/c1-37-17-5-16-34-20-24(27-7-2-3-8-30(27)34)21-35(25-10-11-25)31(36)28-19-32-15-13-26(28)22-9-12-29-23(18-22)6-4-14-33-29/h2-4,6-9,12,14,18,20,25-26,28,32H,5,10-11,13,15-17,19,21H2,1H3/t26-,28+/m1/s1 |
| InChIKey | PZDCCHKKLHUSKI-IAPPQJPRSA-N |
| XLogP | 5.11 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|