C22H22F2N4O6 — CID 11993471
N-(2,5-difluorophenyl)-3-[(2-methoxy-5-nitrophenyl)methyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 11993471) has the molecular formula C22H22F2N4O6 and a molecular weight of 476.44 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-3-[(2-methoxy-5-nitrophenyl)methyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-3-[(2-methoxy-5-nitrophenyl)methyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 11993471 |
| Molecular Formula | C22H22F2N4O6 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-(2,5-difluorophenyl)-3-[(2-methoxy-5-nitrophenyl)methyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CC2(CCN(C(=O)Nc3cc(F)ccc3F)CC2)OC1=O |
| InChI | InChI=1S/C22H22F2N4O6/c1-33-19-5-3-16(28(31)32)10-14(19)12-27-13-22(34-21(27)30)6-8-26(9-7-22)20(29)25-18-11-15(23)2-4-17(18)24/h2-5,10-11H,6-9,12-13H2,1H3,(H,25,29) |
| InChIKey | ODWIKHAWZVKRDU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|