C21H16F2N2O5 — CID 7519487
N-(2,5-difluorophenyl)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]acetamide (PubChem CID 7519487) has the molecular formula C21H16F2N2O5 and a molecular weight of 414.36 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]acetamide.
| Compound Name | N-(2,5-difluorophenyl)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]acetamide |
|---|---|
| PubChem CID | 7519487 |
| Molecular Formula | C21H16F2N2O5 |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]acetamide |
| SMILES | COc1ccc(-c2cc([N+](=O)[O-])ccc2OCC(=O)Nc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C21H16F2N2O5/c1-29-16-6-2-13(3-7-16)17-11-15(25(27)28)5-9-20(17)30-12-21(26)24-19-10-14(22)4-8-18(19)23/h2-11H,12H2,1H3,(H,24,26) |
| InChIKey | XYACICKTCPUZOM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|