C21H15F2NO5 — CID 7519463
1-(3,4-difluorophenyl)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]ethanone (PubChem CID 7519463) has the molecular formula C21H15F2NO5 and a molecular weight of 399.35 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]ethanone.
| Compound Name | 1-(3,4-difluorophenyl)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]ethanone |
|---|---|
| PubChem CID | 7519463 |
| Molecular Formula | C21H15F2NO5 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-[2-(4-methoxyphenyl)-4-nitrophenoxy]ethanone |
| SMILES | COc1ccc(-c2cc([N+](=O)[O-])ccc2OCC(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C21H15F2NO5/c1-28-16-6-2-13(3-7-16)17-11-15(24(26)27)5-9-21(17)29-12-20(25)14-4-8-18(22)19(23)10-14/h2-11H,12H2,1H3 |
| InChIKey | KKHFVGLAEUDRCE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|