C17H24N2O3S — CID 119936406
N-[3-(oxolan-2-ylmethoxy)phenyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119936406) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[3-(oxolan-2-ylmethoxy)phenyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[3-(oxolan-2-ylmethoxy)phenyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119936406 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-[3-(oxolan-2-ylmethoxy)phenyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | O=C(CC1CSCCN1)Nc1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C17H24N2O3S/c20-17(10-14-12-23-8-6-18-14)19-13-3-1-4-15(9-13)22-11-16-5-2-7-21-16/h1,3-4,9,14,16,18H,2,5-8,10-12H2,(H,19,20) |
| InChIKey | UQGHYMARLBDUAB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |