C16H27Cl2N3O2S — CID 119941065
N-[3-[2-(dimethylamino)ethoxy]phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941065) has the molecular formula C16H27Cl2N3O2S and a molecular weight of 396.38 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)ethoxy]phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-[3-[2-(dimethylamino)ethoxy]phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941065 |
| Molecular Formula | C16H27Cl2N3O2S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[3-[2-(dimethylamino)ethoxy]phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | CN(C)CCOc1cccc(NC(=O)CC2CSCCN2)c1.Cl.Cl |
| InChI | InChI=1S/C16H25N3O2S.2ClH/c1-19(2)7-8-21-15-5-3-4-13(10-15)18-16(20)11-14-12-22-9-6-17-14;;/h3-5,10,14,17H,6-9,11-12H2,1-2H3,(H,18,20);2*1H |
| InChIKey | XJLUXQIILVSBJX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |