C15H20Cl2N4OS — CID 119941815
N-[3-(1H-imidazol-2-yl)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941815) has the molecular formula C15H20Cl2N4OS and a molecular weight of 375.33 g/mol. Its IUPAC name is N-[3-(1H-imidazol-2-yl)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-[3-(1H-imidazol-2-yl)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941815 |
| Molecular Formula | C15H20Cl2N4OS |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-[3-(1H-imidazol-2-yl)phenyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CSCCN1)Nc1cccc(-c2ncc[nH]2)c1 |
| InChI | InChI=1S/C15H18N4OS.2ClH/c20-14(9-13-10-21-7-6-16-13)19-12-3-1-2-11(8-12)15-17-4-5-18-15;;/h1-5,8,13,16H,6-7,9-10H2,(H,17,18)(H,19,20);2*1H |
| InChIKey | RFKPFPRSHGOCOB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |