C16H24ClN3O2S — CID 119936632
N-[2-[benzyl(methyl)amino]-2-oxoethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119936632) has the molecular formula C16H24ClN3O2S and a molecular weight of 357.91 g/mol. Its IUPAC name is N-[2-[benzyl(methyl)amino]-2-oxoethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[2-[benzyl(methyl)amino]-2-oxoethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119936632 |
| Molecular Formula | C16H24ClN3O2S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[2-[benzyl(methyl)amino]-2-oxoethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | CN(Cc1ccccc1)C(=O)CNC(=O)CC1CSCCN1.Cl |
| InChI | InChI=1S/C16H23N3O2S.ClH/c1-19(11-13-5-3-2-4-6-13)16(21)10-18-15(20)9-14-12-22-8-7-17-14;/h2-6,14,17H,7-12H2,1H3,(H,18,20);1H |
| InChIKey | HWYSHPWQHWCSLK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |