C16H25ClN2O3S — CID 119937075
N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119937075) has the molecular formula C16H25ClN2O3S and a molecular weight of 360.91 g/mol. Its IUPAC name is N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119937075 |
| Molecular Formula | C16H25ClN2O3S |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-[2-(2-methoxyphenoxy)ethyl]-N-methyl-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | COc1ccccc1OCCN(C)C(=O)CC1CSCCN1.Cl |
| InChI | InChI=1S/C16H24N2O3S.ClH/c1-18(16(19)11-13-12-22-10-7-17-13)8-9-21-15-6-4-3-5-14(15)20-2;/h3-6,13,17H,7-12H2,1-2H3;1H |
| InChIKey | LFNPCZSFIFLFPM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |