C16H22ClN3O2S — CID 119937332
N-(4-chlorophenyl)-4-[(2-thiomorpholin-3-ylacetyl)amino]butanamide (PubChem CID 119937332) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[(2-thiomorpholin-3-ylacetyl)amino]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[(2-thiomorpholin-3-ylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 119937332 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-(4-chlorophenyl)-4-[(2-thiomorpholin-3-ylacetyl)amino]butanamide |
| SMILES | O=C(CC1CSCCN1)NCCCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClN3O2S/c17-12-3-5-13(6-4-12)20-15(21)2-1-7-19-16(22)10-14-11-23-9-8-18-14/h3-6,14,18H,1-2,7-11H2,(H,19,22)(H,20,21) |
| InChIKey | RZGUEZGPMJBEHJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|