C18H26N2O3S — CID 119938884
methyl 2-[(3-methylphenyl)methyl]-3-[(2-thiomorpholin-3-ylacetyl)amino]propanoate (PubChem CID 119938884) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is methyl 2-[(3-methylphenyl)methyl]-3-[(2-thiomorpholin-3-ylacetyl)amino]propanoate.
| Compound Name | methyl 2-[(3-methylphenyl)methyl]-3-[(2-thiomorpholin-3-ylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 119938884 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | methyl 2-[(3-methylphenyl)methyl]-3-[(2-thiomorpholin-3-ylacetyl)amino]propanoate |
| SMILES | COC(=O)C(CNC(=O)CC1CSCCN1)Cc1cccc(C)c1 |
| InChI | InChI=1S/C18H26N2O3S/c1-13-4-3-5-14(8-13)9-15(18(22)23-2)11-20-17(21)10-16-12-24-7-6-19-16/h3-5,8,15-16,19H,6-7,9-12H2,1-2H3,(H,20,21) |
| InChIKey | WSZSZTJBTFXVBX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |