C17H26BrClN2OS — CID 119939586
N-[2-[(3-bromophenyl)methyl]butyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119939586) has the molecular formula C17H26BrClN2OS and a molecular weight of 421.83 g/mol. Its IUPAC name is N-[2-[(3-bromophenyl)methyl]butyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[2-[(3-bromophenyl)methyl]butyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119939586 |
| Molecular Formula | C17H26BrClN2OS |
| Molecular Weight | 421.83 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-[2-[(3-bromophenyl)methyl]butyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | CCC(CNC(=O)CC1CSCCN1)Cc1cccc(Br)c1.Cl |
| InChI | InChI=1S/C17H25BrN2OS.ClH/c1-2-13(8-14-4-3-5-15(18)9-14)11-20-17(21)10-16-12-22-7-6-19-16;/h3-5,9,13,16,19H,2,6-8,10-12H2,1H3,(H,20,21);1H |
| InChIKey | OZJGLEZVISBPQZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |