C15H31Cl2N3O2S — CID 119940987
N-(3-methyl-2-morpholin-4-ylbutyl)-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119940987) has the molecular formula C15H31Cl2N3O2S and a molecular weight of 388.41 g/mol. Its IUPAC name is N-(3-methyl-2-morpholin-4-ylbutyl)-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-(3-methyl-2-morpholin-4-ylbutyl)-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119940987 |
| Molecular Formula | C15H31Cl2N3O2S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-(3-methyl-2-morpholin-4-ylbutyl)-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | CC(C)C(CNC(=O)CC1CSCCN1)N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C15H29N3O2S.2ClH/c1-12(2)14(18-4-6-20-7-5-18)10-17-15(19)9-13-11-21-8-3-16-13;;/h12-14,16H,3-11H2,1-2H3,(H,17,19);2*1H |
| InChIKey | URMDXZLZUONPTK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |