C16H32N4OS — CID 119942614
N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119942614) has the molecular formula C16H32N4OS and a molecular weight of 328.53 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119942614 |
| Molecular Formula | C16H32N4OS |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | CCN1CCN(CC(C)CNC(=O)CC2CSCCN2)CC1 |
| InChI | InChI=1S/C16H32N4OS/c1-3-19-5-7-20(8-6-19)12-14(2)11-18-16(21)10-15-13-22-9-4-17-15/h14-15,17H,3-13H2,1-2H3,(H,18,21) |
| InChIKey | KAPAVZSDJONSKX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |