C13H27Cl2N3OS — CID 119941344
N-[(1-ethylpyrrolidin-3-yl)methyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941344) has the molecular formula C13H27Cl2N3OS and a molecular weight of 344.35 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-3-yl)methyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-[(1-ethylpyrrolidin-3-yl)methyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941344 |
| Molecular Formula | C13H27Cl2N3OS |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[(1-ethylpyrrolidin-3-yl)methyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | CCN1CCC(CNC(=O)CC2CSCCN2)C1.Cl.Cl |
| InChI | InChI=1S/C13H25N3OS.2ClH/c1-2-16-5-3-11(9-16)8-15-13(17)7-12-10-18-6-4-14-12;;/h11-12,14H,2-10H2,1H3,(H,15,17);2*1H |
| InChIKey | BMNQOYACKVRXCM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |