C14H29Cl2N3OS — CID 119941640
N-[2-(1-methylpiperidin-4-yl)ethyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride (PubChem CID 119941640) has the molecular formula C14H29Cl2N3OS and a molecular weight of 358.38 g/mol. Its IUPAC name is N-[2-(1-methylpiperidin-4-yl)ethyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride.
| Compound Name | N-[2-(1-methylpiperidin-4-yl)ethyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119941640 |
| Molecular Formula | C14H29Cl2N3OS |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[2-(1-methylpiperidin-4-yl)ethyl]-2-thiomorpholin-3-ylacetamide;dihydrochloride |
| SMILES | CN1CCC(CCNC(=O)CC2CSCCN2)CC1.Cl.Cl |
| InChI | InChI=1S/C14H27N3OS.2ClH/c1-17-7-3-12(4-8-17)2-5-16-14(18)10-13-11-19-9-6-15-13;;/h12-13,15H,2-11H2,1H3,(H,16,18);2*1H |
| InChIKey | IKYMFWRAQNDCEP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |