C18H27N3O3S — CID 119942543
N-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119942543) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119942543 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]-2-thiomorpholin-3-ylacetamide |
| SMILES | COc1cc(OC)cc(N2CCC(NC(=O)CC3CSCCN3)C2)c1 |
| InChI | InChI=1S/C18H27N3O3S/c1-23-16-8-15(9-17(10-16)24-2)21-5-3-13(11-21)20-18(22)7-14-12-25-6-4-19-14/h8-10,13-14,19H,3-7,11-12H2,1-2H3,(H,20,22) |
| InChIKey | LXMZCHGIINOLTQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |