C17H26N2O4 — CID 119943959
3-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]piperidine-3-carboxamide (PubChem CID 119943959) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | 3-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119943959 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]piperidine-3-carboxamide |
| SMILES | COc1cc(CNC(=O)C2(C)CCCNC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H26N2O4/c1-17(6-5-7-18-11-17)16(20)19-10-12-8-13(21-2)15(23-4)14(9-12)22-3/h8-9,18H,5-7,10-11H2,1-4H3,(H,19,20) |
| InChIKey | DKIXRHPSRMNRFR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |